C25H24ClN3O7S2 — CID 137447547
[5-[4-[(4-tert-butylphenyl)sulfonylamino]-7-chloro-1,3-dioxoisoindol-2-yl]-4-methyl-3-pyridinyl] methanesulfonate (PubChem CID 137447547) has the molecular formula C25H24ClN3O7S2 and a molecular weight of 578.07 g/mol. Its IUPAC name is [5-[4-[(4-tert-butylphenyl)sulfonylamino]-7-chloro-1,3-dioxoisoindol-2-yl]-4-methyl-3-pyridinyl] methanesulfonate.
| Compound Name | [5-[4-[(4-tert-butylphenyl)sulfonylamino]-7-chloro-1,3-dioxoisoindol-2-yl]-4-methyl-3-pyridinyl] methanesulfonate |
|---|---|
| PubChem CID | 137447547 |
| Molecular Formula | C25H24ClN3O7S2 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | [5-[4-[(4-tert-butylphenyl)sulfonylamino]-7-chloro-1,3-dioxoisoindol-2-yl]-4-methyl-3-pyridinyl] methanesulfonate |
| SMILES | Cc1c(OS(C)(=O)=O)cncc1N1C(=O)c2c(Cl)ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2C1=O |
| InChI | InChI=1S/C25H24ClN3O7S2/c1-14-19(12-27-13-20(14)36-37(5,32)33)29-23(30)21-17(26)10-11-18(22(21)24(29)31)28-38(34,35)16-8-6-15(7-9-16)25(2,3)4/h6-13,28H,1-5H3 |
| InChIKey | JCDGYGYQSZFCJZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|