C24H16Cl2F3N3O4S — CID 162572010
4-chloro-N-[7-chloro-2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-methyl-3-(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 162572010) has the molecular formula C24H16Cl2F3N3O4S and a molecular weight of 570.38 g/mol. Its IUPAC name is 4-chloro-N-[7-chloro-2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-methyl-3-(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 4-chloro-N-[7-chloro-2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-methyl-3-(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 162572010 |
| Molecular Formula | C24H16Cl2F3N3O4S |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 569.02 |
| IUPAC Name | 4-chloro-N-[7-chloro-2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-methyl-3-(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CC1(Cl)C=CC(S(=O)(=O)Nc2ccc(Cl)c3c2C(=O)N(Cc2cccc(C#N)c2)C3=O)=CC1C(F)(F)F |
| InChI | InChI=1S/C24H16Cl2F3N3O4S/c1-23(26)8-7-15(10-18(23)24(27,28)29)37(35,36)31-17-6-5-16(25)19-20(17)22(34)32(21(19)33)12-14-4-2-3-13(9-14)11-30/h2-10,18,31H,12H2,1H3 |
| InChIKey | SNNFPDOOROSXMZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|