C17H12N2O2 — CID 61146244
3-[(7-methyl-2,3-dioxoindol-1-yl)methyl]benzonitrile (PubChem CID 61146244) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-[(7-methyl-2,3-dioxoindol-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(7-methyl-2,3-dioxoindol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 61146244 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-[(7-methyl-2,3-dioxoindol-1-yl)methyl]benzonitrile |
| SMILES | Cc1cccc2c1N(Cc1cccc(C#N)c1)C(=O)C2=O |
| InChI | InChI=1S/C17H12N2O2/c1-11-4-2-7-14-15(11)19(17(21)16(14)20)10-13-6-3-5-12(8-13)9-18/h2-8H,10H2,1H3 |
| InChIKey | DLXJHOSSUBKHAC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|