C16H17N3O2 — CID 66153029
7-methyl-1-[(3-propylimidazol-4-yl)methyl]indole-2,3-dione (PubChem CID 66153029) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 7-methyl-1-[(3-propylimidazol-4-yl)methyl]indole-2,3-dione.
| Compound Name | 7-methyl-1-[(3-propylimidazol-4-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 66153029 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 7-methyl-1-[(3-propylimidazol-4-yl)methyl]indole-2,3-dione |
| SMILES | CCCn1cncc1CN1C(=O)C(=O)c2cccc(C)c21 |
| InChI | InChI=1S/C16H17N3O2/c1-3-7-18-10-17-8-12(18)9-19-14-11(2)5-4-6-13(14)15(20)16(19)21/h4-6,8,10H,3,7,9H2,1-2H3 |
| InChIKey | REVZJZHPBLJUQO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|