C17H10Cl2NO4S- — CID 7042318
2,4-dichloro-5-(naphthalen-1-ylsulfamoyl)benzoate (PubChem CID 7042318) has the molecular formula C17H10Cl2NO4S- and a molecular weight of 395.24 g/mol. Its IUPAC name is 2,4-dichloro-5-(naphthalen-1-ylsulfamoyl)benzoate.
| Compound Name | 2,4-dichloro-5-(naphthalen-1-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7042318 |
| Molecular Formula | C17H10Cl2NO4S- |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 2,4-dichloro-5-(naphthalen-1-ylsulfamoyl)benzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)Nc2cccc3ccccc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2NO4S/c18-13-9-14(19)16(8-12(13)17(21)22)25(23,24)20-15-7-3-5-10-4-1-2-6-11(10)15/h1-9,20H,(H,21,22)/p-1 |
| InChIKey | BLOKKBJGKJFRLK-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |