C15H11Cl3NO6S- — CID 2368816
2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoate (PubChem CID 2368816) has the molecular formula C15H11Cl3NO6S- and a molecular weight of 439.68 g/mol. Its IUPAC name is 2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoate.
| Compound Name | 2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2368816 |
| Molecular Formula | C15H11Cl3NO6S- |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 437.94 |
| IUPAC Name | 2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1cc(OC)c(NS(=O)(=O)c2cc(C(=O)[O-])c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl3NO6S/c1-24-12-6-13(25-2)11(5-9(12)17)19-26(22,23)14-3-7(15(20)21)8(16)4-10(14)18/h3-6,19H,1-2H3,(H,20,21)/p-1 |
| InChIKey | GZRALVIQOKBQGS-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |