C21H14Cl6N2O5S — CID 5178353
2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 5178353) has the molecular formula C21H14Cl6N2O5S and a molecular weight of 619.14 g/mol. Its IUPAC name is 2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 5178353 |
| Molecular Formula | C21H14Cl6N2O5S |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 615.88 |
| IUPAC Name | 2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | COc1cc(OC)c(NS(=O)(=O)c2cc(C(=O)Nc3cc(Cl)c(Cl)cc3Cl)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl6N2O5S/c1-33-18-8-19(34-2)17(7-14(18)26)29-35(31,32)20-3-9(10(22)4-15(20)27)21(30)28-16-6-12(24)11(23)5-13(16)25/h3-8,29H,1-2H3,(H,28,30) |
| InChIKey | XZEGQFSRQLBXAB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|