C21H20Cl3N5O6S — CID 167975018
2,4-dichloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-[[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide (PubChem CID 167975018) has the molecular formula C21H20Cl3N5O6S and a molecular weight of 576.85 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-[[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-[[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167975018 |
| Molecular Formula | C21H20Cl3N5O6S |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 575.02 |
| IUPAC Name | 2,4-dichloro-N-(5-chloro-2,4-dimethoxyphenyl)-5-[[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCc1cc(=O)[nH]c(NNC(=O)c2cc(S(=O)(=O)Nc3cc(Cl)c(OC)cc3OC)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C21H20Cl3N5O6S/c1-4-10-5-19(30)26-21(25-10)28-27-20(31)11-6-18(14(24)7-12(11)22)36(32,33)29-15-8-13(23)16(34-2)9-17(15)35-3/h5-9,29H,4H2,1-3H3,(H,27,31)(H2,25,26,28,30) |
| InChIKey | XUEMOEKYPOTXBK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|