C20H19Cl2N5O4S — CID 155967702
2-chloro-N-(4-chlorophenyl)-5-[[(6-oxo-4-propyl-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide (PubChem CID 155967702) has the molecular formula C20H19Cl2N5O4S and a molecular weight of 496.38 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)-5-[[(6-oxo-4-propyl-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)-5-[[(6-oxo-4-propyl-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155967702 |
| Molecular Formula | C20H19Cl2N5O4S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)-5-[[(6-oxo-4-propyl-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCCc1cc(=O)[nH]c(NNC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)n1 |
| InChI | InChI=1S/C20H19Cl2N5O4S/c1-2-3-15-11-18(28)24-20(23-15)26-25-19(29)12-4-9-16(22)17(10-12)32(30,31)27-14-7-5-13(21)6-8-14/h4-11,27H,2-3H2,1H3,(H,25,29)(H2,23,24,26,28) |
| InChIKey | FZRYXBUGPBAJNG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|