C16H20ClN5O4S — CID 135534211
2-chloro-N,N-diethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide (PubChem CID 135534211) has the molecular formula C16H20ClN5O4S and a molecular weight of 413.89 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N,N-diethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135534211 |
| Molecular Formula | C16H20ClN5O4S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-chloro-N,N-diethyl-5-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NNc2nc(C)cc(=O)[nH]2)ccc1Cl |
| InChI | InChI=1S/C16H20ClN5O4S/c1-4-22(5-2)27(25,26)13-9-11(6-7-12(13)17)15(24)20-21-16-18-10(3)8-14(23)19-16/h6-9H,4-5H2,1-3H3,(H,20,24)(H2,18,19,21,23) |
| InChIKey | OVVMVKWGXFRZDS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|