C21H16Cl5N3O5S — CID 2345083
N-(4-amino-3,5-dichlorophenyl)-2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzamide (PubChem CID 2345083) has the molecular formula C21H16Cl5N3O5S and a molecular weight of 599.71 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2345083 |
| Molecular Formula | C21H16Cl5N3O5S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 596.93 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2,4-dichloro-5-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1cc(OC)c(NS(=O)(=O)c2cc(C(=O)Nc3cc(Cl)c(N)c(Cl)c3)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl5N3O5S/c1-33-17-8-18(34-2)16(7-12(17)23)29-35(31,32)19-5-10(11(22)6-13(19)24)21(30)28-9-3-14(25)20(27)15(26)4-9/h3-8,29H,27H2,1-2H3,(H,28,30) |
| InChIKey | YMDDNGVICGBKEY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|