C15H12Cl2NO5S- — CID 2119292
2,4-dichloro-5-[(4-methoxyphenyl)methylsulfamoyl]benzoate (PubChem CID 2119292) has the molecular formula C15H12Cl2NO5S- and a molecular weight of 389.24 g/mol. Its IUPAC name is 2,4-dichloro-5-[(4-methoxyphenyl)methylsulfamoyl]benzoate.
| Compound Name | 2,4-dichloro-5-[(4-methoxyphenyl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2119292 |
| Molecular Formula | C15H12Cl2NO5S- |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2,4-dichloro-5-[(4-methoxyphenyl)methylsulfamoyl]benzoate |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(C(=O)[O-])c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO5S/c1-23-10-4-2-9(3-5-10)8-18-24(21,22)14-6-11(15(19)20)12(16)7-13(14)17/h2-7,18H,8H2,1H3,(H,19,20)/p-1 |
| InChIKey | ABSCWQLZMNGFSG-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |