C20H19ClN2O6S — CID 155452009
4-chloro-2-(furan-2-ylmethylamino)-5-[(4-methoxyphenyl)methylsulfamoyl]benzoic acid (PubChem CID 155452009) has the molecular formula C20H19ClN2O6S and a molecular weight of 450.90 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-5-[(4-methoxyphenyl)methylsulfamoyl]benzoic acid.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-5-[(4-methoxyphenyl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155452009 |
| Molecular Formula | C20H19ClN2O6S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-5-[(4-methoxyphenyl)methylsulfamoyl]benzoic acid |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(C(=O)O)c(NCc3ccco3)cc2Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O6S/c1-28-14-6-4-13(5-7-14)11-23-30(26,27)19-9-16(20(24)25)18(10-17(19)21)22-12-15-3-2-8-29-15/h2-10,22-23H,11-12H2,1H3,(H,24,25) |
| InChIKey | IZDRZKFGEKFCAN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |