C18H25ClN4O7S — CID 18649645
4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 18649645) has the molecular formula C18H25ClN4O7S and a molecular weight of 476.94 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 18649645 |
| Molecular Formula | C18H25ClN4O7S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.NS(=O)(=O)c1cc(C(=O)O)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O5S.C6H14N2O2/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19;7-4-2-1-3-5(8)6(9)10/h1-5,15H,6H2,(H,16,17)(H2,14,18,19);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | CBKCRNSUIWKDDG-ZSCHJXSPSA-N |
| XLogP | 1.42 |
| TPSA | 211.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|