C12H11Cl2KN2O5S — CID 138402493
potassium;4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate;hydrochloride (PubChem CID 138402493) has the molecular formula C12H11Cl2KN2O5S and a molecular weight of 405.30 g/mol. Its IUPAC name is potassium;4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate;hydrochloride.
| Compound Name | potassium;4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 138402493 |
| Molecular Formula | C12H11Cl2KN2O5S |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 403.94 |
| IUPAC Name | potassium;4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1cc(C(=O)[O-])c(NCc2ccco2)cc1Cl.[K+] |
| InChI | InChI=1S/C12H11ClN2O5S.ClH.K/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19;;/h1-5,15H,6H2,(H,16,17)(H2,14,18,19);1H;/q;;+1/p-1 |
| InChIKey | OBQXJHXAVCXBHK-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |