C19H25ClN4O4S — CID 66628217
4-chloro-2-(furan-2-ylmethylamino)-N-(2-piperidin-1-ylethyl)-5-sulfamoylbenzamide (PubChem CID 66628217) has the molecular formula C19H25ClN4O4S and a molecular weight of 440.95 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-N-(2-piperidin-1-ylethyl)-5-sulfamoylbenzamide.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-N-(2-piperidin-1-ylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 66628217 |
| Molecular Formula | C19H25ClN4O4S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-N-(2-piperidin-1-ylethyl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCN2CCCCC2)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C19H25ClN4O4S/c20-16-12-17(23-13-14-5-4-10-28-14)15(11-18(16)29(21,26)27)19(25)22-6-9-24-7-2-1-3-8-24/h4-5,10-12,23H,1-3,6-9,13H2,(H,22,25)(H2,21,26,27) |
| InChIKey | WWQSZCVBDIXBHE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |