C16H22ClN3O3S — CID 143014238
5-aminosulfanyl-4-chloro-2-(furan-2-ylmethylamino)-N-(2-hydroxyethyl)benzamide;ethane (PubChem CID 143014238) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is 5-aminosulfanyl-4-chloro-2-(furan-2-ylmethylamino)-N-(2-hydroxyethyl)benzamide;ethane.
| Compound Name | 5-aminosulfanyl-4-chloro-2-(furan-2-ylmethylamino)-N-(2-hydroxyethyl)benzamide;ethane |
|---|---|
| PubChem CID | 143014238 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-aminosulfanyl-4-chloro-2-(furan-2-ylmethylamino)-N-(2-hydroxyethyl)benzamide;ethane |
| SMILES | CC.NSc1cc(C(=O)NCCO)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C14H16ClN3O3S.C2H6/c15-11-7-12(18-8-9-2-1-5-21-9)10(6-13(11)22-16)14(20)17-3-4-19;1-2/h1-2,5-7,18-19H,3-4,8,16H2,(H,17,20);1-2H3 |
| InChIKey | YMFWRZWEFMLJKW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|