C25H23Cl2N4O9S2- — CID 91223273
5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)benzoate;1-[5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)phenyl]ethanone (PubChem CID 91223273) has the molecular formula C25H23Cl2N4O9S2- and a molecular weight of 658.52 g/mol. Its IUPAC name is 5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)benzoate;1-[5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)phenyl]ethanone.
| Compound Name | 5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)benzoate;1-[5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 91223273 |
| Molecular Formula | C25H23Cl2N4O9S2- |
| Molecular Weight | 658.52 g/mol |
| Exact Mass | 657.03 |
| IUPAC Name | 5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)benzoate;1-[5-aminoperoxysulfanyl-4-chloro-2-(furan-2-ylmethylamino)phenyl]ethanone |
| SMILES | CC(=O)c1cc(SOON)c(Cl)cc1NCc1ccco1.NOOSc1cc(C(=O)[O-])c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C13H13ClN2O4S.C12H11ClN2O5S/c1-8(17)10-5-13(21-20-19-15)11(14)6-12(10)16-7-9-3-2-4-18-9;13-9-5-10(15-6-7-2-1-3-18-7)8(12(16)17)4-11(9)21-20-19-14/h2-6,16H,7,15H2,1H3;1-5,15H,6,14H2,(H,16,17)/p-1 |
| InChIKey | UBCYHGNVACLCSF-UHFFFAOYSA-M |
| XLogP | 5.31 |
| TPSA | 196.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|