C17H19ClN2O7S — CID 155796067
(1-ethoxy-1-oxopropan-2-yl) 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 155796067) has the molecular formula C17H19ClN2O7S and a molecular weight of 430.87 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 155796067 |
| Molecular Formula | C17H19ClN2O7S |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | CCOC(=O)C(C)OC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C17H19ClN2O7S/c1-3-25-16(21)10(2)27-17(22)12-7-15(28(19,23)24)13(18)8-14(12)20-9-11-5-4-6-26-11/h4-8,10,20H,3,9H2,1-2H3,(H2,19,23,24) |
| InChIKey | MDJYUMOMTQESHG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |