C28H30ClF2N3O8S — CID 69129276
[4-[(2R)-2-[(3,5-difluorobenzoyl)-ethylamino]propoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 69129276) has the molecular formula C28H30ClF2N3O8S and a molecular weight of 642.08 g/mol. Its IUPAC name is [4-[(2R)-2-[(3,5-difluorobenzoyl)-ethylamino]propoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | [4-[(2R)-2-[(3,5-difluorobenzoyl)-ethylamino]propoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 69129276 |
| Molecular Formula | C28H30ClF2N3O8S |
| Molecular Weight | 642.08 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | [4-[(2R)-2-[(3,5-difluorobenzoyl)-ethylamino]propoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | CCN(C(=O)c1cc(F)cc(F)c1)[C@H](C)COC(=O)CCCOC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C28H30ClF2N3O8S/c1-3-34(27(36)18-10-19(30)12-20(31)11-18)17(2)16-42-26(35)7-5-9-41-28(37)22-13-25(43(32,38)39)23(29)14-24(22)33-15-21-6-4-8-40-21/h4,6,8,10-14,17,33H,3,5,7,9,15-16H2,1-2H3,(H2,32,38,39)/t17-/m1/s1 |
| InChIKey | CRVMOWDBBIEBLI-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|