C26H27ClF2N2O7S — CID 59613211
[(2R,3R,5S)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethyloxan-4-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 59613211) has the molecular formula C26H27ClF2N2O7S and a molecular weight of 585.03 g/mol. Its IUPAC name is [(2R,3R,5S)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethyloxan-4-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | [(2R,3R,5S)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethyloxan-4-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 59613211 |
| Molecular Formula | C26H27ClF2N2O7S |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | [(2R,3R,5S)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethyloxan-4-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | C[C@@H]1CO[C@@](O)(c2cc(F)cc(F)c2)[C@H](C)C1COC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C26H27ClF2N2O7S/c1-14-12-38-26(33,16-6-17(28)8-18(29)7-16)15(2)21(14)13-37-25(32)20-9-24(39(30,34)35)22(27)10-23(20)31-11-19-4-3-5-36-19/h3-10,14-15,21,31,33H,11-13H2,1-2H3,(H2,30,34,35)/t14-,15-,21?,26-/m1/s1 |
| InChIKey | HWSQEYMHLAEOMO-OFGRTCKVSA-N |
| XLogP | 4.39 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |