C29H32ClF2N3O9S — CID 58916388
[4-[[(2S,3S,5R)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethylmorpholin-4-yl]methoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 58916388) has the molecular formula C29H32ClF2N3O9S and a molecular weight of 672.10 g/mol. Its IUPAC name is [4-[[(2S,3S,5R)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethylmorpholin-4-yl]methoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | [4-[[(2S,3S,5R)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethylmorpholin-4-yl]methoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 58916388 |
| Molecular Formula | C29H32ClF2N3O9S |
| Molecular Weight | 672.10 g/mol |
| Exact Mass | 671.15 |
| IUPAC Name | [4-[[(2S,3S,5R)-2-(3,5-difluorophenyl)-2-hydroxy-3,5-dimethylmorpholin-4-yl]methoxy]-4-oxobutyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | C[C@@H]1CO[C@@](O)(c2cc(F)cc(F)c2)[C@H](C)N1COC(=O)CCCOC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C29H32ClF2N3O9S/c1-17-15-44-29(38,19-9-20(31)11-21(32)10-19)18(2)35(17)16-43-27(36)6-4-8-42-28(37)23-12-26(45(33,39)40)24(30)13-25(23)34-14-22-5-3-7-41-22/h3,5,7,9-13,17-18,34,38H,4,6,8,14-16H2,1-2H3,(H2,33,39,40)/t17-,18+,29-/m1/s1 |
| InChIKey | RQVGOZPOGMEXHQ-UOSLOYJQSA-N |
| XLogP | 3.86 |
| TPSA | 170.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.10 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|