C13H10ClN3O4S — CID 141273993
4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoyl cyanide (PubChem CID 141273993) has the molecular formula C13H10ClN3O4S and a molecular weight of 339.76 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoyl cyanide.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoyl cyanide |
|---|---|
| PubChem CID | 141273993 |
| Molecular Formula | C13H10ClN3O4S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoyl cyanide |
| SMILES | N#CC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C13H10ClN3O4S/c14-10-5-11(17-7-8-2-1-3-21-8)9(12(18)6-15)4-13(10)22(16,19)20/h1-5,17H,7H2,(H2,16,19,20) |
| InChIKey | MCXRQIDVOYSIKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|