C17H22ClN3O4S2 — CID 46853545
S-[3-(dimethylamino)propyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenecarbothioate (PubChem CID 46853545) has the molecular formula C17H22ClN3O4S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is S-[3-(dimethylamino)propyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenecarbothioate.
| Compound Name | S-[3-(dimethylamino)propyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenecarbothioate |
|---|---|
| PubChem CID | 46853545 |
| Molecular Formula | C17H22ClN3O4S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | S-[3-(dimethylamino)propyl] 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenecarbothioate |
| SMILES | CN(C)CCCSC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C17H22ClN3O4S2/c1-21(2)6-4-8-26-17(22)13-9-16(27(19,23)24)14(18)10-15(13)20-11-12-5-3-7-25-12/h3,5,7,9-10,20H,4,6,8,11H2,1-2H3,(H2,19,23,24) |
| InChIKey | JYVPIOYSXIEDPV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|