C15H17ClN2O6S — CID 118302031
2-methoxyethyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 118302031) has the molecular formula C15H17ClN2O6S and a molecular weight of 388.83 g/mol. Its IUPAC name is 2-methoxyethyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | 2-methoxyethyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 118302031 |
| Molecular Formula | C15H17ClN2O6S |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-methoxyethyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | COCCOC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C15H17ClN2O6S/c1-22-5-6-24-15(19)11-7-14(25(17,20)21)12(16)8-13(11)18-9-10-3-2-4-23-10/h2-4,7-8,18H,5-6,9H2,1H3,(H2,17,20,21) |
| InChIKey | FHUQNYTWHUYXQR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|