C13H11ClN2O5S2 — CID 87081207
methanethioyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 87081207) has the molecular formula C13H11ClN2O5S2 and a molecular weight of 374.83 g/mol. Its IUPAC name is methanethioyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | methanethioyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 87081207 |
| Molecular Formula | C13H11ClN2O5S2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | methanethioyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OC=S)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C13H11ClN2O5S2/c14-10-5-11(16-6-8-2-1-3-20-8)9(13(17)21-7-22)4-12(10)23(15,18)19/h1-5,7,16H,6H2,(H2,15,18,19) |
| InChIKey | LJJSORQLNDIEDX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|