C21H21ClN4O10S — CID 162370895
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate (PubChem CID 162370895) has the molecular formula C21H21ClN4O10S and a molecular weight of 556.94 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 162370895 |
| Molecular Formula | C21H21ClN4O10S |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C21H21ClN4O10S/c22-12-7-13(24-8-10-2-1-5-34-10)11(6-15(12)37(23,32)33)20(30)35-9-14-17(28)18(29)19(36-14)26-4-3-16(27)25-21(26)31/h1-7,14,17-19,24,28-29H,8-9H2,(H2,23,32,33)(H,25,27,31)/t14-,17-,18-,19-/m1/s1 |
| InChIKey | NRVFGMZQKMXPKS-UTRMSSBJSA-N |
| XLogP | -0.48 |
| TPSA | 216.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |