C15H13ClN4O4S — CID 58344429
2-chloro-4-(furan-2-ylmethylamino)-5-(imidazole-1-carbonyl)benzenesulfonamide (PubChem CID 58344429) has the molecular formula C15H13ClN4O4S and a molecular weight of 380.81 g/mol. Its IUPAC name is 2-chloro-4-(furan-2-ylmethylamino)-5-(imidazole-1-carbonyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-(furan-2-ylmethylamino)-5-(imidazole-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58344429 |
| Molecular Formula | C15H13ClN4O4S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-chloro-4-(furan-2-ylmethylamino)-5-(imidazole-1-carbonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)n2ccnc2)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C15H13ClN4O4S/c16-12-7-13(19-8-10-2-1-5-24-10)11(6-14(12)25(17,22)23)15(21)20-4-3-18-9-20/h1-7,9,19H,8H2,(H2,17,22,23) |
| InChIKey | CUSXPYXEOJJOGG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |