C10H11N3O3S — CID 171984499
4-(furan-2-ylmethylamino)pyridine-3-sulfonamide (PubChem CID 171984499) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 4-(furan-2-ylmethylamino)pyridine-3-sulfonamide.
| Compound Name | 4-(furan-2-ylmethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 171984499 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-(furan-2-ylmethylamino)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cnccc1NCc1ccco1 |
| InChI | InChI=1S/C10H11N3O3S/c11-17(14,15)10-7-12-4-3-9(10)13-6-8-2-1-5-16-8/h1-5,7H,6H2,(H,12,13)(H2,11,14,15) |
| InChIKey | BAZWJSMVNRIBLS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |