C14H17N2NaO8S3 — CID 23722348
sodium 2-(furan-2-ylmethylamino)-4-propylsulfonyl-5-sulfamoylbenzenesulfonate (PubChem CID 23722348) has the molecular formula C14H17N2NaO8S3 and a molecular weight of 460.49 g/mol. Its IUPAC name is sodium 2-(furan-2-ylmethylamino)-4-propylsulfonyl-5-sulfamoylbenzenesulfonate.
| Compound Name | sodium 2-(furan-2-ylmethylamino)-4-propylsulfonyl-5-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 23722348 |
| Molecular Formula | C14H17N2NaO8S3 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | sodium 2-(furan-2-ylmethylamino)-4-propylsulfonyl-5-sulfamoylbenzenesulfonate |
| SMILES | CCCS(=O)(=O)c1cc(NCc2ccco2)c(S(=O)(=O)[O-])cc1S(N)(=O)=O.[Na+] |
| InChI | InChI=1S/C14H18N2O8S3.Na/c1-2-6-25(17,18)13-7-11(16-9-10-4-3-5-24-10)12(27(21,22)23)8-14(13)26(15,19)20;/h3-5,7-8,16H,2,6,9H2,1H3,(H2,15,19,20)(H,21,22,23);/q;+1/p-1 |
| InChIKey | FFSLYRAZKGJFLA-UHFFFAOYSA-M |
| XLogP | -2.37 |
| TPSA | 176.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|