C15H20N2O7S3 — CID 13045659
4-butylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid (PubChem CID 13045659) has the molecular formula C15H20N2O7S3 and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-butylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid.
| Compound Name | 4-butylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 13045659 |
| Molecular Formula | C15H20N2O7S3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 4-butylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid |
| SMILES | CCCCS(=O)c1cc(NCc2ccco2)c(S(=O)(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H20N2O7S3/c1-2-3-7-25(18)13-8-12(17-10-11-5-4-6-24-11)14(27(21,22)23)9-15(13)26(16,19)20/h4-6,8-9,17H,2-3,7,10H2,1H3,(H2,16,19,20)(H,21,22,23) |
| InChIKey | QXSBYHGWDCWTHG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|