C17H21N2NaO7S3 — CID 23683972
sodium 4-cyclohexylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonate (PubChem CID 23683972) has the molecular formula C17H21N2NaO7S3 and a molecular weight of 484.55 g/mol. Its IUPAC name is sodium 4-cyclohexylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonate.
| Compound Name | sodium 4-cyclohexylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 23683972 |
| Molecular Formula | C17H21N2NaO7S3 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | sodium 4-cyclohexylsulfinyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonate |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)[O-])c(NCc2ccco2)cc1S(=O)C1CCCCC1.[Na+] |
| InChI | InChI=1S/C17H22N2O7S3.Na/c18-28(21,22)17-10-16(29(23,24)25)14(19-11-12-5-4-8-26-12)9-15(17)27(20)13-6-2-1-3-7-13;/h4-5,8-10,13,19H,1-3,6-7,11H2,(H2,18,21,22)(H,23,24,25);/q;+1/p-1 |
| InChIKey | PJEDUAHPHIJBSB-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 159.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|