C18H17KN2O7S2 — CID 23683957
potassium 2-[2-(furan-2-yl)ethylamino]-4-phenoxy-5-sulfamoylbenzenesulfonate (PubChem CID 23683957) has the molecular formula C18H17KN2O7S2 and a molecular weight of 476.57 g/mol. Its IUPAC name is potassium 2-[2-(furan-2-yl)ethylamino]-4-phenoxy-5-sulfamoylbenzenesulfonate.
| Compound Name | potassium 2-[2-(furan-2-yl)ethylamino]-4-phenoxy-5-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 23683957 |
| Molecular Formula | C18H17KN2O7S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | potassium 2-[2-(furan-2-yl)ethylamino]-4-phenoxy-5-sulfamoylbenzenesulfonate |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)[O-])c(NCCc2ccco2)cc1Oc1ccccc1.[K+] |
| InChI | InChI=1S/C18H18N2O7S2.K/c19-28(21,22)18-12-17(29(23,24)25)15(20-9-8-13-7-4-10-26-13)11-16(18)27-14-5-2-1-3-6-14;/h1-7,10-12,20H,8-9H2,(H2,19,21,22)(H,23,24,25);/q;+1/p-1 |
| InChIKey | FQHDEUOUPGPAMD-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 151.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|