C12H12ClN2NaO6S2 — CID 23683943
sodium 4-chloro-2-[2-(furan-2-yl)ethylamino]-5-sulfamoylbenzenesulfonate (PubChem CID 23683943) has the molecular formula C12H12ClN2NaO6S2 and a molecular weight of 402.81 g/mol. Its IUPAC name is sodium 4-chloro-2-[2-(furan-2-yl)ethylamino]-5-sulfamoylbenzenesulfonate.
| Compound Name | sodium 4-chloro-2-[2-(furan-2-yl)ethylamino]-5-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 23683943 |
| Molecular Formula | C12H12ClN2NaO6S2 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | sodium 4-chloro-2-[2-(furan-2-yl)ethylamino]-5-sulfamoylbenzenesulfonate |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)[O-])c(NCCc2ccco2)cc1Cl.[Na+] |
| InChI | InChI=1S/C12H13ClN2O6S2.Na/c13-9-6-10(15-4-3-8-2-1-5-21-8)12(23(18,19)20)7-11(9)22(14,16)17;/h1-2,5-7,15H,3-4H2,(H2,14,16,17)(H,18,19,20);/q;+1/p-1 |
| InChIKey | JPWXUJRCTDGOMP-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|