C14H13ClFNO5S — CID 158900963
fluoromethyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate (PubChem CID 158900963) has the molecular formula C14H13ClFNO5S and a molecular weight of 361.78 g/mol. Its IUPAC name is fluoromethyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate.
| Compound Name | fluoromethyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 158900963 |
| Molecular Formula | C14H13ClFNO5S |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | fluoromethyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCF)c(CCc2ccco2)cc1Cl |
| InChI | InChI=1S/C14H13ClFNO5S/c15-12-6-9(3-4-10-2-1-5-21-10)11(14(18)22-8-16)7-13(12)23(17,19)20/h1-2,5-7H,3-4,8H2,(H2,17,19,20) |
| InChIKey | JFKZKVBNFUVMLV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |