C14H14ClNO5S — CID 162250451
4-chloro-2-[2-(furan-2-yl)ethyl]-5-(methylsulfamoyl)benzoic acid (PubChem CID 162250451) has the molecular formula C14H14ClNO5S and a molecular weight of 343.79 g/mol. Its IUPAC name is 4-chloro-2-[2-(furan-2-yl)ethyl]-5-(methylsulfamoyl)benzoic acid.
| Compound Name | 4-chloro-2-[2-(furan-2-yl)ethyl]-5-(methylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 162250451 |
| Molecular Formula | C14H14ClNO5S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-chloro-2-[2-(furan-2-yl)ethyl]-5-(methylsulfamoyl)benzoic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)O)c(CCc2ccco2)cc1Cl |
| InChI | InChI=1S/C14H14ClNO5S/c1-16-22(19,20)13-8-11(14(17)18)9(7-12(13)15)4-5-10-3-2-6-21-10/h2-3,6-8,16H,4-5H2,1H3,(H,17,18) |
| InChIKey | ZXXLOQDXXJWSGF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |