C20H16ClNO4 — CID 167593834
4-chloro-2-[2-(furan-2-yl)ethyl]-5-(phenylcarbamoyl)benzoic acid (PubChem CID 167593834) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is 4-chloro-2-[2-(furan-2-yl)ethyl]-5-(phenylcarbamoyl)benzoic acid.
| Compound Name | 4-chloro-2-[2-(furan-2-yl)ethyl]-5-(phenylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 167593834 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-chloro-2-[2-(furan-2-yl)ethyl]-5-(phenylcarbamoyl)benzoic acid |
| SMILES | O=C(Nc1ccccc1)c1cc(C(=O)O)c(CCc2ccco2)cc1Cl |
| InChI | InChI=1S/C20H16ClNO4/c21-18-11-13(8-9-15-7-4-10-26-15)16(20(24)25)12-17(18)19(23)22-14-5-2-1-3-6-14/h1-7,10-12H,8-9H2,(H,22,23)(H,24,25) |
| InChIKey | ITWKOFZFVOGIHT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |