C14H11Cl2NO4 — CID 82811030
3,5-dichloro-4-[3-(furan-2-yl)propanoylamino]benzoic acid (PubChem CID 82811030) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is 3,5-dichloro-4-[3-(furan-2-yl)propanoylamino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[3-(furan-2-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 82811030 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3,5-dichloro-4-[3-(furan-2-yl)propanoylamino]benzoic acid |
| SMILES | O=C(CCc1ccco1)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO4/c15-10-6-8(14(19)20)7-11(16)13(10)17-12(18)4-3-9-2-1-5-21-9/h1-2,5-7H,3-4H2,(H,17,18)(H,19,20) |
| InChIKey | YEBJICIAFJJNBH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |