C13H12Br2N2O2 — CID 43548458
N-(2-amino-4,6-dibromophenyl)-3-(furan-2-yl)propanamide (PubChem CID 43548458) has the molecular formula C13H12Br2N2O2 and a molecular weight of 388.06 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-3-(furan-2-yl)propanamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 43548458 |
| Molecular Formula | C13H12Br2N2O2 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-3-(furan-2-yl)propanamide |
| SMILES | Nc1cc(Br)cc(Br)c1NC(=O)CCc1ccco1 |
| InChI | InChI=1S/C13H12Br2N2O2/c14-8-6-10(15)13(11(16)7-8)17-12(18)4-3-9-2-1-5-19-9/h1-2,5-7H,3-4,16H2,(H,17,18) |
| InChIKey | GXRNSEBKSXJTHM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|