C14H13NO5 — CID 107264676
3-[3-(furan-2-yl)propanoylamino]-4-hydroxybenzoic acid (PubChem CID 107264676) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)propanoylamino]-4-hydroxybenzoic acid.
| Compound Name | 3-[3-(furan-2-yl)propanoylamino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 107264676 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[3-(furan-2-yl)propanoylamino]-4-hydroxybenzoic acid |
| SMILES | O=C(CCc1ccco1)Nc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C14H13NO5/c16-12-5-3-9(14(18)19)8-11(12)15-13(17)6-4-10-2-1-7-20-10/h1-3,5,7-8,16H,4,6H2,(H,15,17)(H,18,19) |
| InChIKey | UBIDRZSDNSEGOM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|