C20H18ClNO5S — CID 58344447
benzyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate (PubChem CID 58344447) has the molecular formula C20H18ClNO5S and a molecular weight of 419.89 g/mol. Its IUPAC name is benzyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate.
| Compound Name | benzyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 58344447 |
| Molecular Formula | C20H18ClNO5S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | benzyl 4-chloro-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCc2ccccc2)c(CCc2ccco2)cc1Cl |
| InChI | InChI=1S/C20H18ClNO5S/c21-18-11-15(8-9-16-7-4-10-26-16)17(12-19(18)28(22,24)25)20(23)27-13-14-5-2-1-3-6-14/h1-7,10-12H,8-9,13H2,(H2,22,24,25) |
| InChIKey | VMQDFIATUVYLRL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |