C17H21ClN2O4S — CID 58033695
4-chloro-N,N-diethyl-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzamide (PubChem CID 58033695) has the molecular formula C17H21ClN2O4S and a molecular weight of 384.89 g/mol. Its IUPAC name is 4-chloro-N,N-diethyl-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzamide.
| Compound Name | 4-chloro-N,N-diethyl-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 58033695 |
| Molecular Formula | C17H21ClN2O4S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-chloro-N,N-diethyl-2-[2-(furan-2-yl)ethyl]-5-sulfamoylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(N)(=O)=O)c(Cl)cc1CCc1ccco1 |
| InChI | InChI=1S/C17H21ClN2O4S/c1-3-20(4-2)17(21)14-11-16(25(19,22)23)15(18)10-12(14)7-8-13-6-5-9-24-13/h5-6,9-11H,3-4,7-8H2,1-2H3,(H2,19,22,23) |
| InChIKey | YRPTUZDDGQVBEO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |