C19H20N2O7S2 — CID 13045686
5-(dimethylsulfamoyl)-2-(furan-2-ylmethylamino)-4-phenoxybenzenesulfonic acid (PubChem CID 13045686) has the molecular formula C19H20N2O7S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-(furan-2-ylmethylamino)-4-phenoxybenzenesulfonic acid.
| Compound Name | 5-(dimethylsulfamoyl)-2-(furan-2-ylmethylamino)-4-phenoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 13045686 |
| Molecular Formula | C19H20N2O7S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-(furan-2-ylmethylamino)-4-phenoxybenzenesulfonic acid |
| SMILES | CN(C)S(=O)(=O)c1cc(S(=O)(=O)O)c(NCc2ccco2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C19H20N2O7S2/c1-21(2)29(22,23)19-12-18(30(24,25)26)16(20-13-15-9-6-10-27-15)11-17(19)28-14-7-4-3-5-8-14/h3-12,20H,13H2,1-2H3,(H,24,25,26) |
| InChIKey | NXGMEGGXMYAPAQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|