C16H22N2O8S3 — CID 20532395
2-(furan-2-ylmethylamino)-4-pentylsulfonyl-5-sulfamoylbenzenesulfonic acid (PubChem CID 20532395) has the molecular formula C16H22N2O8S3 and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-4-pentylsulfonyl-5-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-(furan-2-ylmethylamino)-4-pentylsulfonyl-5-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 20532395 |
| Molecular Formula | C16H22N2O8S3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-4-pentylsulfonyl-5-sulfamoylbenzenesulfonic acid |
| SMILES | CCCCCS(=O)(=O)c1cc(NCc2ccco2)c(S(=O)(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H22N2O8S3/c1-2-3-4-8-27(19,20)15-9-13(18-11-12-6-5-7-26-12)14(29(23,24)25)10-16(15)28(17,21)22/h5-7,9-10,18H,2-4,8,11H2,1H3,(H2,17,21,22)(H,23,24,25) |
| InChIKey | FAFLPBJCFKPYKD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|