C19H26N2O8S3 — CID 20532391
4-cyclooctylsulfonyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid (PubChem CID 20532391) has the molecular formula C19H26N2O8S3 and a molecular weight of 506.62 g/mol. Its IUPAC name is 4-cyclooctylsulfonyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid.
| Compound Name | 4-cyclooctylsulfonyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 20532391 |
| Molecular Formula | C19H26N2O8S3 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 4-cyclooctylsulfonyl-2-(furan-2-ylmethylamino)-5-sulfamoylbenzenesulfonic acid |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)O)c(NCc2ccco2)cc1S(=O)(=O)C1CCCCCCC1 |
| InChI | InChI=1S/C19H26N2O8S3/c20-31(24,25)19-12-17(32(26,27)28)16(21-13-14-7-6-10-29-14)11-18(19)30(22,23)15-8-4-2-1-3-5-9-15/h6-7,10-12,15,21H,1-5,8-9,13H2,(H2,20,24,25)(H,26,27,28) |
| InChIKey | FVYLUEKFGUCZTH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|