C15H13N3O3 — CID 53369783
3-(furan-2-ylmethylamino)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 53369783) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-(furan-2-ylmethylamino)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(furan-2-ylmethylamino)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53369783 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-(furan-2-ylmethylamino)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2cccnc2)c(NCc2ccco2)c1=O |
| InChI | InChI=1S/C15H13N3O3/c19-14-12(17-8-10-3-1-5-16-7-10)13(15(14)20)18-9-11-4-2-6-21-11/h1-7,17-18H,8-9H2 |
| InChIKey | NQZVMDKSCYONNX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|