C20H20N4O2 — CID 53369125
3-(4-phenylpiperazin-1-yl)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 53369125) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-(4-phenylpiperazin-1-yl)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-phenylpiperazin-1-yl)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53369125 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-(4-phenylpiperazin-1-yl)-4-(pyridin-3-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2cccnc2)c(N2CCN(c3ccccc3)CC2)c1=O |
| InChI | InChI=1S/C20H20N4O2/c25-19-17(22-14-15-5-4-8-21-13-15)18(20(19)26)24-11-9-23(10-12-24)16-6-2-1-3-7-16/h1-8,13,22H,9-12,14H2 |
| InChIKey | HTELEKBNNLIRLD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|