C21H19ClFN3O2 — CID 53369691
3-[(2-chlorophenyl)methylamino]-4-[4-(4-fluorophenyl)piperazin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 53369691) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]-4-[4-(4-fluorophenyl)piperazin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2-chlorophenyl)methylamino]-4-[4-(4-fluorophenyl)piperazin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53369691 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]-4-[4-(4-fluorophenyl)piperazin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccccc2Cl)c(N2CCN(c3ccc(F)cc3)CC2)c1=O |
| InChI | InChI=1S/C21H19ClFN3O2/c22-17-4-2-1-3-14(17)13-24-18-19(21(28)20(18)27)26-11-9-25(10-12-26)16-7-5-15(23)6-8-16/h1-8,24H,9-13H2 |
| InChIKey | JWBSEGLGGTUWBX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|