C21H27ClN4O — CID 109021431
N-[(2-chlorophenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide (PubChem CID 109021431) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide |
|---|---|
| PubChem CID | 109021431 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide |
| SMILES | CN1CCN(c2ccc(NCCC(=O)NCc3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C21H27ClN4O/c1-25-12-14-26(15-13-25)19-8-6-18(7-9-19)23-11-10-21(27)24-16-17-4-2-3-5-20(17)22/h2-9,23H,10-16H2,1H3,(H,24,27) |
| InChIKey | ANKFXGMVYOJKKE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|