C22H30N4O — CID 109019204
N-[(2-methylphenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide (PubChem CID 109019204) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide.
| Compound Name | N-[(2-methylphenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide |
|---|---|
| PubChem CID | 109019204 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide |
| SMILES | Cc1ccccc1CNC(=O)CCNc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O/c1-18-5-3-4-6-19(18)17-24-22(27)11-12-23-20-7-9-21(10-8-20)26-15-13-25(2)14-16-26/h3-10,23H,11-17H2,1-2H3,(H,24,27) |
| InChIKey | NTSNQDVZGBOAOG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|